Deck 15: Chemical Equilibrium

ملء الشاشة (f)
exit full mode
سؤال
At equilibrium, the forward reaction rate is greater than the reverse reaction rate.
استخدم زر المسافة أو
up arrow
down arrow
لقلب البطاقة.
سؤال
Identify the equilibrium constant expression for the following reaction: 2C8H18( g)+25O2( g)f16CO2( g)+18H2O(g)2 \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } ( \mathrm {~g} ) + 25 \mathrm { O } _ { 2 } ( \mathrm {~g} ) f \quad 16 \mathrm { CO } _ { 2 } ( \mathrm {~g} ) + 18 \mathrm { H } _ { 2 } \mathrm { O } ( \mathrm { g } )

A) [CO2]16[H2O]18[C8H18]2[O2]25\frac { \left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } } { \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 } }
B) [CO2]16[H2O]13[C8H18]2[O2]25\left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 13 } \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 }
C) [CO2]16[H2O]18[C8H18]2[O2]25\left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } - \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 }
D) [CO2]16[H2O]18+[C8H18]2[O2]25\left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } + \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 }
E) [C8H18]2[O2]25[CO2]16[H2O]18\frac { \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } - \left[ \mathrm { O } _ { 2 } \right] ^ { 25 } } { \left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } - \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } }
سؤال
Identify the expression for KpK _ { \mathrm { p } } for the reaction CaCO3( s)fCaO(s)+CO2( g)\mathrm { CaCO } _ { 3 } ( \mathrm {~s} ) f \quad \mathrm { CaO } ( \mathrm { s } ) + \mathrm { CO } _ { 2 } ( \mathrm {~g} ) .  <strong>Identify the expression for  K _ { \mathrm { p } }  for the reaction  \mathrm { CaCO } _ { 3 } ( \mathrm {~s} ) f \quad \mathrm { CaO } ( \mathrm { s } ) + \mathrm { CO } _ { 2 } ( \mathrm {~g} )  .  </strong> A)  K _ { \mathrm { p } } = P _ { \mathrm { CO } _ { 2 } }  B)  K _ { \mathrm { p } } = P _ { \mathrm { Ca0 } }  C)  K _ { \mathrm { p } } = P _ { \mathrm { CaCO } _ { 3 } }  D)  K_{\mathrm{p}}=\frac{\left(P_{\mathrm{CO}_{2}}\right)\left(P_{\mathrm{CaO}}\right)}{\left(P_{\mathrm{CaCO}_{3}}\right)}  E)  K _ { \mathrm { p } } = \frac { \left( P _ { \mathrm { CaCO } } \right) } { \left( P _ { \mathrm { CO } _ { 2 } } \right) \left( P _ { \mathrm { CaO } } \right) }  <div style=padding-top: 35px>

A) Kp=PCO2K _ { \mathrm { p } } = P _ { \mathrm { CO } _ { 2 } }
B) Kp=PCa0K _ { \mathrm { p } } = P _ { \mathrm { Ca0 } }
C) Kp=PCaCO3K _ { \mathrm { p } } = P _ { \mathrm { CaCO } _ { 3 } }
D) Kp=(PCO2)(PCaO)(PCaCO3)K_{\mathrm{p}}=\frac{\left(P_{\mathrm{CO}_{2}}\right)\left(P_{\mathrm{CaO}}\right)}{\left(P_{\mathrm{CaCO}_{3}}\right)}
E) Kp=(PCaCO)(PCO2)(PCaO)K _ { \mathrm { p } } = \frac { \left( P _ { \mathrm { CaCO } } \right) } { \left( P _ { \mathrm { CO } _ { 2 } } \right) \left( P _ { \mathrm { CaO } } \right) }
سؤال
The equilibrium constant of a reaction A+Bf\mathrm { A } + \mathrm { B } f \quad \quad C\mathrm { C } at 320 C{ } ^ { \circ } \mathrm { C } is 9.60 ×105\times 10 ^ { 5 } . At the same temperature, the equilibrium constant for the reverse reaction  Cf       A+B\text { Cf } ~~~~~~\mathrm { A } + \mathrm { B } will be _____.

A) 0.000
B) 9.22 ×1011\times 10 ^ { 11 }
C) 4.80 ×105\times 10 ^ { 5 }
D) 1.04 ×106\times 10 ^ { - 6 }
E) 9.06 ×105\times 10 ^ { 5 }
سؤال
Kp = K only if the moles of gaseous products and gaseous reactants are different.
سؤال
Calculate Kp for the reaction 2SO2( g)+O2( g)f2SO3( g)2 \mathrm { SO } _ { 2 } ( \mathrm {~g} ) + \mathrm { O } _ { 2 } ( \mathrm {~g} ) f \quad 2 \mathrm { SO } _ { 3 } ( \mathrm {~g} ) at a temperature of 439 C{ } ^ { \circ } \mathrm { C } , if K = 5.10 × 104 at the same temperature.

A) 1.90 ×102
B) 8.72 ×102
C) 1.40×103
D) 0.60 ×103
E) 6.50 ×102
سؤال
The unit of equilibrium constant is mol/L.
سؤال
Define chemical equilibrium.
سؤال
_____ constants are calculated using effective concentrations, or activities, of reactants and products.

A) Formation
B) Planck's
C) Dielectric
D) Faraday's
E) Equilibrium
سؤال
Values of equilibrium constant (K) greater than 103 indicate a strong tendency for reactants to form products.
سؤال
_____ is the point at which the forward and reverse reaction rates become the same so that the net composition of the system no longer changes with time.
سؤال
The equilibrium constant for a reaction written in reverse is the same as that written originally.
سؤال
Which of the following is the expression to calculate the equilibrium constant for partial pressures?

A) Kp=(PC)c(PD)d(PA)a(PB)bK _ { \mathrm { p } } = \frac { \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } } { \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } } }
B) Kp=(PC)c(PD)d+(PA)a(PB)bK _ { \mathrm { p } } = \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } + \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } }
C) Kp=(PC)c(PD)d(PA)a(PB)bK _ { \mathrm { p } } = \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } - \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } }
D) KP=(PC)c+(PD)d×(PA)a+(PB)bK _ { \mathrm { P } } = \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } + \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } \times \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } + \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } }
E) Kp=(PA)a(PB)b(PC)c(PD)dK _ { \mathrm { p } } = \frac { \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } - \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } } } { \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } - \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } }
سؤال
Chemical _____ is a dynamic process that consists of a forward reaction, in which reactants are converted to products, and a reverse reaction, in which products are converted to reactants.

A) transition
B) change
C) equilibrium
D) bonding
E) transmutation
سؤال
_____ are the ratios of the measured concentrations to a standard state of 1 M.
سؤال
What does the law of mass action state?

A) The lowest-energy electron configuration for an atom is the one that has the maximum number of electrons with parallel spins in degenerate orbitals.
B) For the general balanced chemical equation a A+b BfcC+dDa \mathrm {~A} + b \mathrm {~B} f \quad c \mathrm { C } + d \mathrm { D } , the equilibrium constant expression is
K=[C]c[D]d[ A]a[ B]bK = \frac { [ \mathrm { C } ] ^ { c } [ \mathrm { D } ] ^ { d } } { [ \mathrm {~A} ] ^ { a } [ \mathrm {~B} ] ^ { b } } .
C) No two electrons in an atom can have the same value of all four quantum numbers.
D) The energy of the universe is constant: ? Euniverse = ? Esystem + ? Esurroundings = 0.
E) The entropy of the universe remains constant in a reversible process, whereas the entropy of the universe increases in an irreversible process.
سؤال
Explain the relationship between the equilibrium constant and the rate constants for the forward and reverse reactions with an example.
سؤال
The composition of an equilibrium mixture is dependent on the direction from which equilibrium is approached.
سؤال
Calculate the equilibrium constant K3 for the reaction CO(g)+2H2 S( g)fCS2( g)+H2O(g)+H2( g)\mathrm { CO } ( \mathrm { g } ) + 2 \mathrm { H } _ { 2 } \mathrm {~S} ( \mathrm {~g} ) f \quad \mathrm { CS } _ { 2 } ( \mathrm {~g} ) + \mathrm { H } _ { 2 } \mathrm { O } ( \mathrm { g } ) + \mathrm { H } _ { 2 } ( \mathrm {~g} ) at 785 C{ } ^ { \circ } \mathrm { C } . Given that the equilibrium constant K1 for the reaction CO(g)+3H2( g)fCH4( g)+H2O(g)\mathrm { CO } ( \mathrm { g } ) + 3 \mathrm { H } _ { 2 } ( \mathrm {~g} ) f \quad \mathrm { CH } _ { 4 } ( \mathrm {~g} ) + \mathrm { H } _ { 2 } \mathrm { O } ( \mathrm { g } ) is 7.34 ×102\times 10 ^ { - 2 } and the equilibrium constant K2 for the reaction CH4( g)+2H2 S( g)fCS2( g)+4H2( g)\mathrm { CH } _ { 4 } ( \mathrm {~g} ) + 2 \mathrm { H } _ { 2 } \mathrm {~S} ( \mathrm {~g} ) f \quad \mathrm { CS } _ { 2 } ( \mathrm {~g} ) + 4 \mathrm { H } _ { 2 } ( \mathrm {~g} ) is 2.89 ×104\times 10 ^ { 4 } .

A) 2.53 ×102\times 10 ^ { 2 }
B) 7.34 ×102\times 10 ^ { - 2 }
C) 2.89 ×104\times 10 ^ { 4 }
D) 4.45 ×103\times 10 ^ { 3 }
E) 2.12 ×103\times 10 ^ { 3 }
سؤال
In the reaction A+Bf\mathrm{A}+\mathrm{B} f \quad \quad C \mathrm{C} , values of the equilibrium constant at various temperatures were found to be K50C=4.60×1032K _ { 50 ^ { \circ } \mathrm { C } } = 4.60 \times 10 ^ { 32 } ,  <strong>In the reaction  \mathrm{A}+\mathrm{B} f    \quad     \quad     \mathrm{C}   , values of the equilibrium constant at various temperatures were found to be  K _ { 50 ^ { \circ } \mathrm { C } } = 4.60 \times 10 ^ { 32 }  ,    K _ { 160 ^ { \circ } \mathrm { C } } = 2.30 \times 10 ^ { 3 }  and  K _ { 256^{?} \mathrm { C } } = 5.80  . At what temperature would the proportion of A and B in the equilibrium mixture be the highest?</strong> A) 206  { } ^ { \circ } \mathrm { C }  B) 256  { } ^ { \circ } \mathrm { C }  C) 150  { } ^ { \circ } \mathrm { C }  D) 110  { } ^ { \circ } \mathrm { C }  E) 160  { } ^ { \circ } \mathrm { C }  <div style=padding-top: 35px>  K160C=2.30×103K _ { 160 ^ { \circ } \mathrm { C } } = 2.30 \times 10 ^ { 3 } and K256?C=5.80K _ { 256^{?} \mathrm { C } } = 5.80 . At what temperature would the proportion of A and B in the equilibrium mixture be the highest?

A) 206 C{ } ^ { \circ } \mathrm { C }
B) 256 C{ } ^ { \circ } \mathrm { C }
C) 150 C{ } ^ { \circ } \mathrm { C }
D) 110 C{ } ^ { \circ } \mathrm { C }
E) 160 C{ } ^ { \circ } \mathrm { C }
سؤال
If Q=KQ = K the system is at equilibrium.
سؤال
Explain the Le Châtelier's Principle.
سؤال
Explain the method to calculate an equilibrium constant from equilibrium concentrations with an example.
سؤال
A system whose reactants, products, or both are in more than one phase is a _____ equilibrium.
سؤال
Calculate Kp for the reaction H2(g)+I2(g)f2HI(g)\mathrm { H } _ { 2 } ( g ) + \mathrm { I } _ { 2 } ( g ) f \quad 2 \mathrm { HI } ( g ) . Given that the mixture of H2 and I2 was maintained at 740 K until the system reached equilibrium, and the equilibrium mixture contained 3.68 × 10?2 M HI, 8.31 × 10?3 M H2, and 7.72 × 10?4 M I2.

A) 3.68 × 10?2
B) 2.11 × 102
C) 5.73 × 103
D) 1.74 × 10?4
E) 8.31 × 10?3
سؤال
A large _____ constant implies that the reactants are converted almost entirely to products.
سؤال
If K > Q, then the ratio of the concentrations of products to the concentrations of reactants is greater than at equilibrium.
سؤال
The equilibrium constant K for the reaction H2( g)+CO2( g)fH2O(g)+CO(g)\mathrm { H } _ { 2 } ( \mathrm {~g} ) + \mathrm { CO } _ { 2 } ( \mathrm {~g} ) f \quad \mathrm { H } _ { 2 } \mathrm { O } ( \mathrm { g } ) + \mathrm { CO } ( \mathrm { g } ) is 0.213 at 640 K. A mixture of gases that initially contains 0.0260 M H2 and 0.0260 M CO2 is allowed to equilibrate at 700 K. Calculate the final concentration of CO2.

A) 1.779 × 10-2
B) 8.203 × 10-3
C) 0.213 × 10-2
D) 0.026 × 10-3
E) 0.052 × 10-2
سؤال
The Le Châtelier's principle states that if stress is applied to a system at equilibrium, the composition of the system remains unchanged.
سؤال
Which of the following statements is true about Q and K?

A) If Q < K, then the ratio of the concentrations of products to the concentrations of reactants is more than the ratio at equilibrium.
B) If Q = K, then the system is at equilibrium.
C) if Q > K, then the ratio of the concentrations of products to the concentrations of reactants is less than at equilibrium.
D) If Q < K, then products are formed at the expense of the reactants.
E) If Q < K, then reactants are formed at the expense of products.
سؤال
A small equilibrium constant implies that the reactants are converted almost entirely to products.
سؤال
_____ are responsible for the scents associated with fruits such as oranges and bananas.

A) Crown ethers
B) Amalgams
C) Cryptands
D) Esters
E) Catalysts
سؤال
For the following reaction A(g)+B(g)f2C(g)A ( g ) + B ( g ) f \quad 2 C ( g ) , Kp=1.8×1025K _ { \mathrm { p } } = 1.8 \times 10 ^ { - 25 } at 30 C{ } ^ { \circ } \mathrm { C } . If PAP _ { \mathrm { A } } = 0.56 atm and PBP _ { B } = 0.18 atm, what will be the partial pressure of C in equilibrium with A and B at 1 atm?

A) 0.18
B) 0.56
C) 6.7 ×1025\times 10 ^ { - 25 }
D) 1.8×10251.8 \times 10 ^ { - 25 }
E) 1.3 ×1013\times 10 ^ { - 13 }
سؤال
Which of the following denotes the reaction quotient Q?

A) [A]a[B]b+[C]c[D]d[ A ] ^ { a } [ B ] ^ { b } + [ C ] ^ { c } [ D ] ^ { d }
B) [A]a[B]b×[C]c[D]d[ A ] ^ { a } [ B ] ^ { b } × [ C ] ^ { c } [ D ] ^ { d }
C) [C]c[D]d[A]a[B]b[ \mathrm { C } ] ^ { \mathrm { c } } [ \mathrm { D } ] ^ { \mathrm { d } } - [ \mathrm { A } ] ^ { \mathrm { a } } [ \mathrm { B } ] ^ { \mathrm { b } }
D) [C]c[D]d[A]a[B]b\frac { [ \mathrm { C } ] ^ { \mathrm { c } } [ \mathrm { D } ] ^ { \mathrm { d } } } { [ \mathrm { A } ] ^ { \mathrm { a } } [ \mathrm { B } ] ^ { \mathrm { b } } }
E) [C]c+[D]d+[A]a+[B]b[ \mathrm { C } ] ^ { \mathrm { c } } + [ \mathrm { D } ] ^ { \mathrm { d } } + [ \mathrm { A } ] ^ { \mathrm { a } } + [ \mathrm { B } ] ^ { \mathrm { b } }
سؤال
Given that at equilibrium [A][ \mathrm { A } ] =0.072 M and [B][ \mathrm { B } ] =0.089 M at 40 C{ } ^ { \circ } \mathrm { C } , calculate the equilibrium constant KK from the equilibrium concentrations for the reaction A(g)fB(g)A ( g ) f \quad B ( g ) .

A) K=0.072K = 0.072
B) K=0.161K = 0.161
C) K=1.23K = 1.23
D) K=0.006K = 0.006
E) K=0.089K = 0.089
سؤال
Define reaction quotient
سؤال
_____ occurs when any change in a system affects the magnitude of Q or K.

A) Suspension
B) Activity
C) Stress
D) Cracking
E) Reforming
سؤال
Which of the following statements refer to the LeChâtelier's Principle?

A) If a stress is applied to a system at equilibrium, the composition of the system will change to relieve the applied stress.
B) The uncertainty in the position of a particle multiplied by the uncertainty in its momentum is greater than or equal to Planck's constant divided by 4π.
C) The energy of electromagnetic radiation is directly proportional to its frequency and inversely proportional to its wavelength.
D) No two electrons in an atom can have the same value of all four quantum numbers.
E) Matter and energy have properties typical of both waves and particles.
سؤال
In the reaction HBr(g)+NaH(s)fNaBr(s)+H2(g)\operatorname { HBr } ( g ) + \operatorname { NaH } ( \mathrm { s } ) f \quad \operatorname { NaBr } ( \mathrm { s } ) + \mathrm { H } _ { 2 } ( g ) ,the concentration of H2(g) will _____ when the concentration of HBr is decreased by a factor of 4.

A) increase by about a factor 2
B) decrease by about a factor 4
C) remain unchanged
D) decrease by about a factor 2
E) increase by about a factor 4
سؤال
A 1.00 mol sample of A was placed in a 2.00 L reactor and heated to 342 C{ } ^ { \circ } \mathrm { C } until the system reached equilibrium. The contents of the reactor then contained 0.0488 mol of C. What is K for the reaction 2A(g) ff 2B(g) +C(g) at the same temperature?

A) 1.45 ×103\times 10 ^ { - 3 }
B) 4.37 ×104\times 10 ^ { - 4 }
C) 2.64 ×104\times 10 ^ { - 4 }
D) 2.85 ×104\times 10 ^ { - 4 }
E) 3.59 ×103\times 10 ^ { - 3 }
سؤال
If Q > K, then the ratio of the concentrations of products to the concentrations of reactants is _____ than at equilibrium.
سؤال
Explain the effect of the changes in temperature on the equilibrium of the system.
سؤال
Explain the effect of changes in total pressure or volume on the equilibrium of the system.
سؤال
The concentration of any gaseous reactant or product is inversely proportional to the applied pressure (P).
سؤال
What would be the reaction quotient for the reaction 2 A(g)f2 B(g)+C(g)2 \mathrm {~A} ( g ) f \quad 2 \mathrm {~B} ( g ) + \mathrm { C } ( g ) if the pressure is decreased by a factor of 2 at constant temperature?

A) Q=14KQ = \frac { 1 } { 4 } K
B) Q=2KQ = 2 K
C) Q=12KQ = \frac { 1 } { 2 } K
D) Q=4KQ = 4 K
E) Q=KQ = K
سؤال
If a balanced chemical equation contains different numbers of gaseous reactant and product molecules, the _____ will be sensitive to changes in volume or pressure.
سؤال
Which of the following statements is true about the effect of changes in temperature on the equilibrium of the system?

A) Increasing the temperature will shift the exothermic reaction to the right.
B) Increasing the temperature decreases the magnitude of the equilibrium constant for an endothermic reaction.
C) Increasing the temperature increases the equilibrium constant for an exothermic reaction.
D) Increasing the temperature has no effect on the equilibrium constant for a thermally neutral reaction. HYPERLINK "http://catalog.flatworldknowledge.com/bookhub/reader/4309?e=averill_1.0-ch08" \l "averill_1.0-ch15_s05_s03_t01"
E) Increasing the temperature will shift the endothermic reaction to the left.
سؤال
In all reactions, if a _____ is applied to a system at equilibrium, the composition of the system will change to counteract the applied stress.
سؤال
Which of the following statements is true about the effect of changes in total pressure or volume on the equilibrium of a system?

A) The concentration of any gaseous reactant or product is directly proportional to the total volume and inversely proportional to the applied pressure.
B) The change in pressure above a liquid solution has little effect on the concentrations of dissolved substances.
C) The concentrations of gases remain constant with pressure.
D) The equilibrium compositions of systems that contain gaseous substances are insensitive to changes in pressure and volume.
E) The change in external pressure has a tremendous effect on an equilibrium system that contains only solids or liquids.
سؤال
What would be the effect of adding carbon dioxide on [CO][ \mathrm { CO } ] in the reaction, CuO(s)+CO(g)fCu(s)+CO2( g)\mathrm { CuO } ( \mathrm { s } ) + \mathrm { CO } ( \mathrm { g } ) f \mathrm { Cu } ( \mathrm { s } ) + \mathrm { CO } _ { 2 } ( \mathrm {~g} ) ?

A) [CO][ \mathrm { CO } ] remains constant
B) [CO][ \mathrm { CO } ] increases
C) [CO][ \mathrm { CO } ] becomes zero
D) [CO][ \mathrm { CO } ] becomes insignificant
E) [CO][ \mathrm { CO } ] decreases
سؤال
Which of the following signifies the relationship between the concentration of a gas and its pressure?

A) C=(RT)PC = ( R T ) ^ { P }
B) C=PRTC = P R T
C) C=PRTC = P - R T
D) C=PRTC = \frac { P } { R T }
E) C=RTPC = \frac { R T } { P }
سؤال
Changing the pressure above a liquid solution has a drastic effect on the concentrations of dissolved substances.
سؤال
A reaction with an unfavorable equilibrium constant can be driven to completion by continually removing one of the _____ of the reaction.
سؤال
_____ states that if a stress is applied to a system at equilibrium, the composition of the system will adjust to counteract the stress.
سؤال
The equilibrium compositions of systems that contain _____ substances are quite sensitive to changes in pressure, volume, and temperature.
سؤال
The _____ has the same form as the equilibrium constant expression, but it is derived from concentrations obtained at any time.
سؤال
Increasing the pressure of a system favors the side of the reaction that has fewer gaseous molecules.
سؤال
A reaction can be forced to go essentially to completion, regardless of the magnitude of K, by continually removing one of the products from the reaction mixture.
سؤال
What would be the effect of decreasing the temperature for the reaction A(g)+3 B(g)f2C(g)\mathrm { A } ( g ) + 3 \mathrm {~B} ( g ) f \quad 2 \mathrm { C } ( g ) given that ΔHrMM=145 kJ/mol\Delta H _ { \mathrm { rMM } } = - 145 \mathrm {~kJ} / \mathrm { mol } ?

A) Equilibrium shifts to the left
B) There is no effect on the reaction
C) Formation of C is favored
D) Decomposition of C is favored
E) C remains constant
سؤال
How can a reaction with an unfavorable equilibrium constant be driven to completion?

A) By continually removing one of the products of the reaction
B) By keeping the temperature of the system constant
C) By keeping the pressure of the system constant
D) By continually removing one of the reactants of the reaction
E) By maintaining equal concentration of the reactants
سؤال
Removing heat from an _____ reaction favors the formation of products.
سؤال
Explain the Sohio acrylonitrile process.
سؤال
_____ control consists of adjusting conditions so that at equilibrium only the desired products are present in significant quantities.
سؤال
Differentiate between kinetic and thermodynamic control.
سؤال
Identify the following kinetically controlled reaction: CH2=CHCH3( g)+NH3( g)+32O2( g)CH2=CHCN(g)+3H2O(g)\mathrm{CH}_{2}=\mathrm{CHCH}_{3}(\mathrm{~g})+\mathrm{NH}_{3}(\mathrm{~g})+\frac{3}{2} \mathrm{O}_{2}(\mathrm{~g}) \rightleftharpoons \mathrm{CH}_{2}=\mathrm{CHC} \equiv \mathrm{N}(\mathrm{g})+3 \mathrm{H}_{2} \mathrm{O}(\mathrm{g})

A) The Haber-Bosch process
B) The Ostwald process
C) The water-gas shift reaction
D) The contact process
E) The Sohio acrylonitrile process
سؤال
_____ is the building block of the polymer called polyacrylonitrile.
سؤال
The altering of reaction conditions so that a single desired product or set of products is present in significant quantities at equilibrium is known as _____ control.

A) potential
B) ionic
C) electrostatic
D) kinetic
E) thermodynamic
سؤال
Which of the following is the thermodynamic controlled reaction that produces ammonia?

A) The contact process
B) The Haber-Bosch process
C) The Ostwald process
D) The water-gas shift reaction
E) The Sohio acrylonitrile process
سؤال
CH2=CHC≡N(g) is the product formed in the Haber-Bosch process.
سؤال
Which of the following is the kinetically controlled reaction that produces CH2=CHCN(g)\mathrm { CH } _ { 2 } = \mathrm { CHC } \equiv \mathrm { N } ( \mathrm { g } ) ?

A) The Sohio acrylonitrile process
B) The contact process
C) The water-gas shift reaction
D) The Haber-Bosch process
E) The Ostwald process
سؤال
The altering of reaction conditions to control reaction rates, thereby obtaining a single desired product or set of products is known as _____ control.

A) thermodynamic
B) potential
C) electrostatic
D) kinetic
E) ionic
سؤال
The Sohio acrylonitrile process involves the reaction of nitrogen and hydrogen to form ammonia.
سؤال
The industrial Haber-Bosch process uses Fe2O3/K2O as the mixed oxide catalyst to enable the reaction to proceed at a significant rate at temperatures of 400°C-530°C.
فتح الحزمة
قم بالتسجيل لفتح البطاقات في هذه المجموعة!
Unlock Deck
Unlock Deck
1/73
auto play flashcards
العب
simple tutorial
ملء الشاشة (f)
exit full mode
Deck 15: Chemical Equilibrium
1
At equilibrium, the forward reaction rate is greater than the reverse reaction rate.
False
2
Identify the equilibrium constant expression for the following reaction: 2C8H18( g)+25O2( g)f16CO2( g)+18H2O(g)2 \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } ( \mathrm {~g} ) + 25 \mathrm { O } _ { 2 } ( \mathrm {~g} ) f \quad 16 \mathrm { CO } _ { 2 } ( \mathrm {~g} ) + 18 \mathrm { H } _ { 2 } \mathrm { O } ( \mathrm { g } )

A) [CO2]16[H2O]18[C8H18]2[O2]25\frac { \left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } } { \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 } }
B) [CO2]16[H2O]13[C8H18]2[O2]25\left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 13 } \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 }
C) [CO2]16[H2O]18[C8H18]2[O2]25\left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } - \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 }
D) [CO2]16[H2O]18+[C8H18]2[O2]25\left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } + \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 }
E) [C8H18]2[O2]25[CO2]16[H2O]18\frac { \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } - \left[ \mathrm { O } _ { 2 } \right] ^ { 25 } } { \left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } - \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } }
[CO2]16[H2O]18[C8H18]2[O2]25\frac { \left[ \mathrm { CO } _ { 2 } \right] ^ { 16 } \left[ \mathrm { H } _ { 2 } \mathrm { O } \right] ^ { 18 } } { \left[ \mathrm { C } _ { 8 } \mathrm { H } _ { 18 } \right] ^ { 2 } \left[ \mathrm { O } _ { 2 } \right] ^ { 25 } }
3
Identify the expression for KpK _ { \mathrm { p } } for the reaction CaCO3( s)fCaO(s)+CO2( g)\mathrm { CaCO } _ { 3 } ( \mathrm {~s} ) f \quad \mathrm { CaO } ( \mathrm { s } ) + \mathrm { CO } _ { 2 } ( \mathrm {~g} ) .  <strong>Identify the expression for  K _ { \mathrm { p } }  for the reaction  \mathrm { CaCO } _ { 3 } ( \mathrm {~s} ) f \quad \mathrm { CaO } ( \mathrm { s } ) + \mathrm { CO } _ { 2 } ( \mathrm {~g} )  .  </strong> A)  K _ { \mathrm { p } } = P _ { \mathrm { CO } _ { 2 } }  B)  K _ { \mathrm { p } } = P _ { \mathrm { Ca0 } }  C)  K _ { \mathrm { p } } = P _ { \mathrm { CaCO } _ { 3 } }  D)  K_{\mathrm{p}}=\frac{\left(P_{\mathrm{CO}_{2}}\right)\left(P_{\mathrm{CaO}}\right)}{\left(P_{\mathrm{CaCO}_{3}}\right)}  E)  K _ { \mathrm { p } } = \frac { \left( P _ { \mathrm { CaCO } } \right) } { \left( P _ { \mathrm { CO } _ { 2 } } \right) \left( P _ { \mathrm { CaO } } \right) }

A) Kp=PCO2K _ { \mathrm { p } } = P _ { \mathrm { CO } _ { 2 } }
B) Kp=PCa0K _ { \mathrm { p } } = P _ { \mathrm { Ca0 } }
C) Kp=PCaCO3K _ { \mathrm { p } } = P _ { \mathrm { CaCO } _ { 3 } }
D) Kp=(PCO2)(PCaO)(PCaCO3)K_{\mathrm{p}}=\frac{\left(P_{\mathrm{CO}_{2}}\right)\left(P_{\mathrm{CaO}}\right)}{\left(P_{\mathrm{CaCO}_{3}}\right)}
E) Kp=(PCaCO)(PCO2)(PCaO)K _ { \mathrm { p } } = \frac { \left( P _ { \mathrm { CaCO } } \right) } { \left( P _ { \mathrm { CO } _ { 2 } } \right) \left( P _ { \mathrm { CaO } } \right) }
Kp=PCO2K _ { \mathrm { p } } = P _ { \mathrm { CO } _ { 2 } }
4
The equilibrium constant of a reaction A+Bf\mathrm { A } + \mathrm { B } f \quad \quad C\mathrm { C } at 320 C{ } ^ { \circ } \mathrm { C } is 9.60 ×105\times 10 ^ { 5 } . At the same temperature, the equilibrium constant for the reverse reaction  Cf       A+B\text { Cf } ~~~~~~\mathrm { A } + \mathrm { B } will be _____.

A) 0.000
B) 9.22 ×1011\times 10 ^ { 11 }
C) 4.80 ×105\times 10 ^ { 5 }
D) 1.04 ×106\times 10 ^ { - 6 }
E) 9.06 ×105\times 10 ^ { 5 }
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
5
Kp = K only if the moles of gaseous products and gaseous reactants are different.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
6
Calculate Kp for the reaction 2SO2( g)+O2( g)f2SO3( g)2 \mathrm { SO } _ { 2 } ( \mathrm {~g} ) + \mathrm { O } _ { 2 } ( \mathrm {~g} ) f \quad 2 \mathrm { SO } _ { 3 } ( \mathrm {~g} ) at a temperature of 439 C{ } ^ { \circ } \mathrm { C } , if K = 5.10 × 104 at the same temperature.

A) 1.90 ×102
B) 8.72 ×102
C) 1.40×103
D) 0.60 ×103
E) 6.50 ×102
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
7
The unit of equilibrium constant is mol/L.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
8
Define chemical equilibrium.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
9
_____ constants are calculated using effective concentrations, or activities, of reactants and products.

A) Formation
B) Planck's
C) Dielectric
D) Faraday's
E) Equilibrium
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
10
Values of equilibrium constant (K) greater than 103 indicate a strong tendency for reactants to form products.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
11
_____ is the point at which the forward and reverse reaction rates become the same so that the net composition of the system no longer changes with time.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
12
The equilibrium constant for a reaction written in reverse is the same as that written originally.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
13
Which of the following is the expression to calculate the equilibrium constant for partial pressures?

A) Kp=(PC)c(PD)d(PA)a(PB)bK _ { \mathrm { p } } = \frac { \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } } { \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } } }
B) Kp=(PC)c(PD)d+(PA)a(PB)bK _ { \mathrm { p } } = \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } + \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } }
C) Kp=(PC)c(PD)d(PA)a(PB)bK _ { \mathrm { p } } = \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } - \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } }
D) KP=(PC)c+(PD)d×(PA)a+(PB)bK _ { \mathrm { P } } = \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } + \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } \times \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } + \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } }
E) Kp=(PA)a(PB)b(PC)c(PD)dK _ { \mathrm { p } } = \frac { \left( P _ { \mathrm { A } } \right) ^ { \mathrm { a } } - \left( P _ { \mathrm { B } } \right) ^ { \mathrm { b } } } { \left( P _ { \mathrm { C } } \right) ^ { \mathrm { c } } - \left( P _ { \mathrm { D } } \right) ^ { \mathrm { d } } }
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
14
Chemical _____ is a dynamic process that consists of a forward reaction, in which reactants are converted to products, and a reverse reaction, in which products are converted to reactants.

A) transition
B) change
C) equilibrium
D) bonding
E) transmutation
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
15
_____ are the ratios of the measured concentrations to a standard state of 1 M.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
16
What does the law of mass action state?

A) The lowest-energy electron configuration for an atom is the one that has the maximum number of electrons with parallel spins in degenerate orbitals.
B) For the general balanced chemical equation a A+b BfcC+dDa \mathrm {~A} + b \mathrm {~B} f \quad c \mathrm { C } + d \mathrm { D } , the equilibrium constant expression is
K=[C]c[D]d[ A]a[ B]bK = \frac { [ \mathrm { C } ] ^ { c } [ \mathrm { D } ] ^ { d } } { [ \mathrm {~A} ] ^ { a } [ \mathrm {~B} ] ^ { b } } .
C) No two electrons in an atom can have the same value of all four quantum numbers.
D) The energy of the universe is constant: ? Euniverse = ? Esystem + ? Esurroundings = 0.
E) The entropy of the universe remains constant in a reversible process, whereas the entropy of the universe increases in an irreversible process.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
17
Explain the relationship between the equilibrium constant and the rate constants for the forward and reverse reactions with an example.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
18
The composition of an equilibrium mixture is dependent on the direction from which equilibrium is approached.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
19
Calculate the equilibrium constant K3 for the reaction CO(g)+2H2 S( g)fCS2( g)+H2O(g)+H2( g)\mathrm { CO } ( \mathrm { g } ) + 2 \mathrm { H } _ { 2 } \mathrm {~S} ( \mathrm {~g} ) f \quad \mathrm { CS } _ { 2 } ( \mathrm {~g} ) + \mathrm { H } _ { 2 } \mathrm { O } ( \mathrm { g } ) + \mathrm { H } _ { 2 } ( \mathrm {~g} ) at 785 C{ } ^ { \circ } \mathrm { C } . Given that the equilibrium constant K1 for the reaction CO(g)+3H2( g)fCH4( g)+H2O(g)\mathrm { CO } ( \mathrm { g } ) + 3 \mathrm { H } _ { 2 } ( \mathrm {~g} ) f \quad \mathrm { CH } _ { 4 } ( \mathrm {~g} ) + \mathrm { H } _ { 2 } \mathrm { O } ( \mathrm { g } ) is 7.34 ×102\times 10 ^ { - 2 } and the equilibrium constant K2 for the reaction CH4( g)+2H2 S( g)fCS2( g)+4H2( g)\mathrm { CH } _ { 4 } ( \mathrm {~g} ) + 2 \mathrm { H } _ { 2 } \mathrm {~S} ( \mathrm {~g} ) f \quad \mathrm { CS } _ { 2 } ( \mathrm {~g} ) + 4 \mathrm { H } _ { 2 } ( \mathrm {~g} ) is 2.89 ×104\times 10 ^ { 4 } .

A) 2.53 ×102\times 10 ^ { 2 }
B) 7.34 ×102\times 10 ^ { - 2 }
C) 2.89 ×104\times 10 ^ { 4 }
D) 4.45 ×103\times 10 ^ { 3 }
E) 2.12 ×103\times 10 ^ { 3 }
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
20
In the reaction A+Bf\mathrm{A}+\mathrm{B} f \quad \quad C \mathrm{C} , values of the equilibrium constant at various temperatures were found to be K50C=4.60×1032K _ { 50 ^ { \circ } \mathrm { C } } = 4.60 \times 10 ^ { 32 } ,  <strong>In the reaction  \mathrm{A}+\mathrm{B} f    \quad     \quad     \mathrm{C}   , values of the equilibrium constant at various temperatures were found to be  K _ { 50 ^ { \circ } \mathrm { C } } = 4.60 \times 10 ^ { 32 }  ,    K _ { 160 ^ { \circ } \mathrm { C } } = 2.30 \times 10 ^ { 3 }  and  K _ { 256^{?} \mathrm { C } } = 5.80  . At what temperature would the proportion of A and B in the equilibrium mixture be the highest?</strong> A) 206  { } ^ { \circ } \mathrm { C }  B) 256  { } ^ { \circ } \mathrm { C }  C) 150  { } ^ { \circ } \mathrm { C }  D) 110  { } ^ { \circ } \mathrm { C }  E) 160  { } ^ { \circ } \mathrm { C }   K160C=2.30×103K _ { 160 ^ { \circ } \mathrm { C } } = 2.30 \times 10 ^ { 3 } and K256?C=5.80K _ { 256^{?} \mathrm { C } } = 5.80 . At what temperature would the proportion of A and B in the equilibrium mixture be the highest?

A) 206 C{ } ^ { \circ } \mathrm { C }
B) 256 C{ } ^ { \circ } \mathrm { C }
C) 150 C{ } ^ { \circ } \mathrm { C }
D) 110 C{ } ^ { \circ } \mathrm { C }
E) 160 C{ } ^ { \circ } \mathrm { C }
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
21
If Q=KQ = K the system is at equilibrium.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
22
Explain the Le Châtelier's Principle.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
23
Explain the method to calculate an equilibrium constant from equilibrium concentrations with an example.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
24
A system whose reactants, products, or both are in more than one phase is a _____ equilibrium.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
25
Calculate Kp for the reaction H2(g)+I2(g)f2HI(g)\mathrm { H } _ { 2 } ( g ) + \mathrm { I } _ { 2 } ( g ) f \quad 2 \mathrm { HI } ( g ) . Given that the mixture of H2 and I2 was maintained at 740 K until the system reached equilibrium, and the equilibrium mixture contained 3.68 × 10?2 M HI, 8.31 × 10?3 M H2, and 7.72 × 10?4 M I2.

A) 3.68 × 10?2
B) 2.11 × 102
C) 5.73 × 103
D) 1.74 × 10?4
E) 8.31 × 10?3
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
26
A large _____ constant implies that the reactants are converted almost entirely to products.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
27
If K > Q, then the ratio of the concentrations of products to the concentrations of reactants is greater than at equilibrium.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
28
The equilibrium constant K for the reaction H2( g)+CO2( g)fH2O(g)+CO(g)\mathrm { H } _ { 2 } ( \mathrm {~g} ) + \mathrm { CO } _ { 2 } ( \mathrm {~g} ) f \quad \mathrm { H } _ { 2 } \mathrm { O } ( \mathrm { g } ) + \mathrm { CO } ( \mathrm { g } ) is 0.213 at 640 K. A mixture of gases that initially contains 0.0260 M H2 and 0.0260 M CO2 is allowed to equilibrate at 700 K. Calculate the final concentration of CO2.

A) 1.779 × 10-2
B) 8.203 × 10-3
C) 0.213 × 10-2
D) 0.026 × 10-3
E) 0.052 × 10-2
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
29
The Le Châtelier's principle states that if stress is applied to a system at equilibrium, the composition of the system remains unchanged.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
30
Which of the following statements is true about Q and K?

A) If Q < K, then the ratio of the concentrations of products to the concentrations of reactants is more than the ratio at equilibrium.
B) If Q = K, then the system is at equilibrium.
C) if Q > K, then the ratio of the concentrations of products to the concentrations of reactants is less than at equilibrium.
D) If Q < K, then products are formed at the expense of the reactants.
E) If Q < K, then reactants are formed at the expense of products.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
31
A small equilibrium constant implies that the reactants are converted almost entirely to products.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
32
_____ are responsible for the scents associated with fruits such as oranges and bananas.

A) Crown ethers
B) Amalgams
C) Cryptands
D) Esters
E) Catalysts
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
33
For the following reaction A(g)+B(g)f2C(g)A ( g ) + B ( g ) f \quad 2 C ( g ) , Kp=1.8×1025K _ { \mathrm { p } } = 1.8 \times 10 ^ { - 25 } at 30 C{ } ^ { \circ } \mathrm { C } . If PAP _ { \mathrm { A } } = 0.56 atm and PBP _ { B } = 0.18 atm, what will be the partial pressure of C in equilibrium with A and B at 1 atm?

A) 0.18
B) 0.56
C) 6.7 ×1025\times 10 ^ { - 25 }
D) 1.8×10251.8 \times 10 ^ { - 25 }
E) 1.3 ×1013\times 10 ^ { - 13 }
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
34
Which of the following denotes the reaction quotient Q?

A) [A]a[B]b+[C]c[D]d[ A ] ^ { a } [ B ] ^ { b } + [ C ] ^ { c } [ D ] ^ { d }
B) [A]a[B]b×[C]c[D]d[ A ] ^ { a } [ B ] ^ { b } × [ C ] ^ { c } [ D ] ^ { d }
C) [C]c[D]d[A]a[B]b[ \mathrm { C } ] ^ { \mathrm { c } } [ \mathrm { D } ] ^ { \mathrm { d } } - [ \mathrm { A } ] ^ { \mathrm { a } } [ \mathrm { B } ] ^ { \mathrm { b } }
D) [C]c[D]d[A]a[B]b\frac { [ \mathrm { C } ] ^ { \mathrm { c } } [ \mathrm { D } ] ^ { \mathrm { d } } } { [ \mathrm { A } ] ^ { \mathrm { a } } [ \mathrm { B } ] ^ { \mathrm { b } } }
E) [C]c+[D]d+[A]a+[B]b[ \mathrm { C } ] ^ { \mathrm { c } } + [ \mathrm { D } ] ^ { \mathrm { d } } + [ \mathrm { A } ] ^ { \mathrm { a } } + [ \mathrm { B } ] ^ { \mathrm { b } }
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
35
Given that at equilibrium [A][ \mathrm { A } ] =0.072 M and [B][ \mathrm { B } ] =0.089 M at 40 C{ } ^ { \circ } \mathrm { C } , calculate the equilibrium constant KK from the equilibrium concentrations for the reaction A(g)fB(g)A ( g ) f \quad B ( g ) .

A) K=0.072K = 0.072
B) K=0.161K = 0.161
C) K=1.23K = 1.23
D) K=0.006K = 0.006
E) K=0.089K = 0.089
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
36
Define reaction quotient
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
37
_____ occurs when any change in a system affects the magnitude of Q or K.

A) Suspension
B) Activity
C) Stress
D) Cracking
E) Reforming
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
38
Which of the following statements refer to the LeChâtelier's Principle?

A) If a stress is applied to a system at equilibrium, the composition of the system will change to relieve the applied stress.
B) The uncertainty in the position of a particle multiplied by the uncertainty in its momentum is greater than or equal to Planck's constant divided by 4π.
C) The energy of electromagnetic radiation is directly proportional to its frequency and inversely proportional to its wavelength.
D) No two electrons in an atom can have the same value of all four quantum numbers.
E) Matter and energy have properties typical of both waves and particles.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
39
In the reaction HBr(g)+NaH(s)fNaBr(s)+H2(g)\operatorname { HBr } ( g ) + \operatorname { NaH } ( \mathrm { s } ) f \quad \operatorname { NaBr } ( \mathrm { s } ) + \mathrm { H } _ { 2 } ( g ) ,the concentration of H2(g) will _____ when the concentration of HBr is decreased by a factor of 4.

A) increase by about a factor 2
B) decrease by about a factor 4
C) remain unchanged
D) decrease by about a factor 2
E) increase by about a factor 4
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
40
A 1.00 mol sample of A was placed in a 2.00 L reactor and heated to 342 C{ } ^ { \circ } \mathrm { C } until the system reached equilibrium. The contents of the reactor then contained 0.0488 mol of C. What is K for the reaction 2A(g) ff 2B(g) +C(g) at the same temperature?

A) 1.45 ×103\times 10 ^ { - 3 }
B) 4.37 ×104\times 10 ^ { - 4 }
C) 2.64 ×104\times 10 ^ { - 4 }
D) 2.85 ×104\times 10 ^ { - 4 }
E) 3.59 ×103\times 10 ^ { - 3 }
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
41
If Q > K, then the ratio of the concentrations of products to the concentrations of reactants is _____ than at equilibrium.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
42
Explain the effect of the changes in temperature on the equilibrium of the system.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
43
Explain the effect of changes in total pressure or volume on the equilibrium of the system.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
44
The concentration of any gaseous reactant or product is inversely proportional to the applied pressure (P).
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
45
What would be the reaction quotient for the reaction 2 A(g)f2 B(g)+C(g)2 \mathrm {~A} ( g ) f \quad 2 \mathrm {~B} ( g ) + \mathrm { C } ( g ) if the pressure is decreased by a factor of 2 at constant temperature?

A) Q=14KQ = \frac { 1 } { 4 } K
B) Q=2KQ = 2 K
C) Q=12KQ = \frac { 1 } { 2 } K
D) Q=4KQ = 4 K
E) Q=KQ = K
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
46
If a balanced chemical equation contains different numbers of gaseous reactant and product molecules, the _____ will be sensitive to changes in volume or pressure.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
47
Which of the following statements is true about the effect of changes in temperature on the equilibrium of the system?

A) Increasing the temperature will shift the exothermic reaction to the right.
B) Increasing the temperature decreases the magnitude of the equilibrium constant for an endothermic reaction.
C) Increasing the temperature increases the equilibrium constant for an exothermic reaction.
D) Increasing the temperature has no effect on the equilibrium constant for a thermally neutral reaction. HYPERLINK "http://catalog.flatworldknowledge.com/bookhub/reader/4309?e=averill_1.0-ch08" \l "averill_1.0-ch15_s05_s03_t01"
E) Increasing the temperature will shift the endothermic reaction to the left.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
48
In all reactions, if a _____ is applied to a system at equilibrium, the composition of the system will change to counteract the applied stress.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
49
Which of the following statements is true about the effect of changes in total pressure or volume on the equilibrium of a system?

A) The concentration of any gaseous reactant or product is directly proportional to the total volume and inversely proportional to the applied pressure.
B) The change in pressure above a liquid solution has little effect on the concentrations of dissolved substances.
C) The concentrations of gases remain constant with pressure.
D) The equilibrium compositions of systems that contain gaseous substances are insensitive to changes in pressure and volume.
E) The change in external pressure has a tremendous effect on an equilibrium system that contains only solids or liquids.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
50
What would be the effect of adding carbon dioxide on [CO][ \mathrm { CO } ] in the reaction, CuO(s)+CO(g)fCu(s)+CO2( g)\mathrm { CuO } ( \mathrm { s } ) + \mathrm { CO } ( \mathrm { g } ) f \mathrm { Cu } ( \mathrm { s } ) + \mathrm { CO } _ { 2 } ( \mathrm {~g} ) ?

A) [CO][ \mathrm { CO } ] remains constant
B) [CO][ \mathrm { CO } ] increases
C) [CO][ \mathrm { CO } ] becomes zero
D) [CO][ \mathrm { CO } ] becomes insignificant
E) [CO][ \mathrm { CO } ] decreases
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
51
Which of the following signifies the relationship between the concentration of a gas and its pressure?

A) C=(RT)PC = ( R T ) ^ { P }
B) C=PRTC = P R T
C) C=PRTC = P - R T
D) C=PRTC = \frac { P } { R T }
E) C=RTPC = \frac { R T } { P }
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
52
Changing the pressure above a liquid solution has a drastic effect on the concentrations of dissolved substances.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
53
A reaction with an unfavorable equilibrium constant can be driven to completion by continually removing one of the _____ of the reaction.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
54
_____ states that if a stress is applied to a system at equilibrium, the composition of the system will adjust to counteract the stress.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
55
The equilibrium compositions of systems that contain _____ substances are quite sensitive to changes in pressure, volume, and temperature.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
56
The _____ has the same form as the equilibrium constant expression, but it is derived from concentrations obtained at any time.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
57
Increasing the pressure of a system favors the side of the reaction that has fewer gaseous molecules.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
58
A reaction can be forced to go essentially to completion, regardless of the magnitude of K, by continually removing one of the products from the reaction mixture.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
59
What would be the effect of decreasing the temperature for the reaction A(g)+3 B(g)f2C(g)\mathrm { A } ( g ) + 3 \mathrm {~B} ( g ) f \quad 2 \mathrm { C } ( g ) given that ΔHrMM=145 kJ/mol\Delta H _ { \mathrm { rMM } } = - 145 \mathrm {~kJ} / \mathrm { mol } ?

A) Equilibrium shifts to the left
B) There is no effect on the reaction
C) Formation of C is favored
D) Decomposition of C is favored
E) C remains constant
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
60
How can a reaction with an unfavorable equilibrium constant be driven to completion?

A) By continually removing one of the products of the reaction
B) By keeping the temperature of the system constant
C) By keeping the pressure of the system constant
D) By continually removing one of the reactants of the reaction
E) By maintaining equal concentration of the reactants
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
61
Removing heat from an _____ reaction favors the formation of products.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
62
Explain the Sohio acrylonitrile process.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
63
_____ control consists of adjusting conditions so that at equilibrium only the desired products are present in significant quantities.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
64
Differentiate between kinetic and thermodynamic control.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
65
Identify the following kinetically controlled reaction: CH2=CHCH3( g)+NH3( g)+32O2( g)CH2=CHCN(g)+3H2O(g)\mathrm{CH}_{2}=\mathrm{CHCH}_{3}(\mathrm{~g})+\mathrm{NH}_{3}(\mathrm{~g})+\frac{3}{2} \mathrm{O}_{2}(\mathrm{~g}) \rightleftharpoons \mathrm{CH}_{2}=\mathrm{CHC} \equiv \mathrm{N}(\mathrm{g})+3 \mathrm{H}_{2} \mathrm{O}(\mathrm{g})

A) The Haber-Bosch process
B) The Ostwald process
C) The water-gas shift reaction
D) The contact process
E) The Sohio acrylonitrile process
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
66
_____ is the building block of the polymer called polyacrylonitrile.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
67
The altering of reaction conditions so that a single desired product or set of products is present in significant quantities at equilibrium is known as _____ control.

A) potential
B) ionic
C) electrostatic
D) kinetic
E) thermodynamic
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
68
Which of the following is the thermodynamic controlled reaction that produces ammonia?

A) The contact process
B) The Haber-Bosch process
C) The Ostwald process
D) The water-gas shift reaction
E) The Sohio acrylonitrile process
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
69
CH2=CHC≡N(g) is the product formed in the Haber-Bosch process.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
70
Which of the following is the kinetically controlled reaction that produces CH2=CHCN(g)\mathrm { CH } _ { 2 } = \mathrm { CHC } \equiv \mathrm { N } ( \mathrm { g } ) ?

A) The Sohio acrylonitrile process
B) The contact process
C) The water-gas shift reaction
D) The Haber-Bosch process
E) The Ostwald process
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
71
The altering of reaction conditions to control reaction rates, thereby obtaining a single desired product or set of products is known as _____ control.

A) thermodynamic
B) potential
C) electrostatic
D) kinetic
E) ionic
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
72
The Sohio acrylonitrile process involves the reaction of nitrogen and hydrogen to form ammonia.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
73
The industrial Haber-Bosch process uses Fe2O3/K2O as the mixed oxide catalyst to enable the reaction to proceed at a significant rate at temperatures of 400°C-530°C.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.
فتح الحزمة
k this deck
locked card icon
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 73 في هذه المجموعة.