Deck 20: Carboxylic Acids

ملء الشاشة (f)
exit full mode
سؤال
Provide the name of the compound shown below. Provide the name of the compound shown below.  <div style=padding-top: 35px>
استخدم زر المسافة أو
up arrow
down arrow
لقلب البطاقة.
سؤال
Provide the structure of 3,3-dimethylheptanoic acid.
سؤال
What is the common name for the following compound? <strong>What is the common name for the following compound?  </strong> A) γ-hydroxyvaleric acid B) γ-hydroxypentanoic acid C) γ-hydroxy-γ-methylbutyric acid D) δ-hydroxyvaleric acid <div style=padding-top: 35px>

A) γ-hydroxyvaleric acid
B) γ-hydroxypentanoic acid
C) γ-hydroxy-γ-methylbutyric acid
D) δ-hydroxyvaleric acid
سؤال
Name the compound shown below. Name the compound shown below.  <div style=padding-top: 35px>
سؤال
Carboxylic acids boil at considerably higher temperatures than do alcohols, ketones, or aldehydes of similar molecular weights. This is because they ________.

A) have a greater oxygen content
B) are more acidic
C) form stable hydrogen-bonded dimers
D) are hydrophobic
E) none of the above
سؤال
Provide the IUPAC name for the compound shown below. Provide the IUPAC name for the compound shown below.  <div style=padding-top: 35px>
سؤال
Provide the IUPAC name for the compound shown below. Provide the IUPAC name for the compound shown below.  <div style=padding-top: 35px>
سؤال
Provide the IUPAC name for the compound shown below. Provide the IUPAC name for the compound shown below.  <div style=padding-top: 35px>
سؤال
Name the compound shown below. Name the compound shown below.  <div style=padding-top: 35px>
سؤال
Draw an acetic acid dimer. Be sure to indicate the hydrogen bonds present.
سؤال
Provide the IUPAC name for HO2CCH2C(CH3)2CH2CH2CO2H.
سؤال
Provide the structure of glutaric acid.
سؤال
Provide the structure of pent-3-ynoic acid.
سؤال
Name the compound shown below. Name the compound shown below.  <div style=padding-top: 35px>
سؤال
Provide the structure of 3-nitrophthalic acid.
سؤال
The common name for pentanedioic acid is ________.

A) pimelic acid
B) oxalic acid
C) glutaric acid
D) succinic acid
E) adipic acid
سؤال
Provide the structure of trans-1,3-cyclohexanedicarboxylic acid.
سؤال
Are carboxylic acids of more than 10 carbons more soluble in polar or nonpolar solvents?
سؤال
The combination of a carbonyl group and a hydroxyl group on the same carbon atom is called a ________ group.

A) carbamate
B) carbonate
C) urethane
D) carboxyl
E) carboxylate
سؤال
Provide the structure of succinic acid.
سؤال
What products result from the reaction of sodium propanoate with hydrobromic acid?
سؤال
Show the deprotonation of benzoic acid by hydroxide and draw the important resonance structures of the carboxylate ion.
سؤال
An ether solution of PhCO2H (A), PhNH2 (B), and PhCH3 (C) is extracted with aqueous NaOH. The ether layer will contain what compound(s) after the extraction?

A) A + B
B) A + C
C) B + C
D) A + B + C
E) A only
سؤال
The pKa1 for oxalic acid (pKa = 1.27) is much lower than the pKa1 of glutaric acid (pKa = 4.35). Briefly explain why.
سؤال
What salt results from the reaction of benzoic acid with potassium hydroxide?
سؤال
An unknown compound is insoluble in water but dissolves in an aqueous solution of sodium bicarbonate with a release of carbon dioxide bubbles. The compound is almost certainly ________.

A) a carboxylic acid
B) an amine
C) an aldehyde
D) an alkyl chloride
E) an alcohol
سؤال
The strongest dichlorobutanoic acid is ________.

A) 2,2-dichlorobutanoic acid
B) 2,3-dichlorobutanoic acid
C) 3,3-dichlorobutanoic acid
D) 3,4-dichlorobutanoic acid
E) 4,4-dichlorobutanoic acid
سؤال
Which of the following sequences ranks the structures below in order of increasing
Acidity? <strong>Which of the following sequences ranks the structures below in order of increasing Acidity?  </strong> A) 1 < 2 < 3 B) 2 < 3 < 1 C) 3 < 1 < 2 D) 2 < 1 < 3 <div style=padding-top: 35px>

A) 1 < 2 < 3
B) 2 < 3 < 1
C) 3 < 1 < 2
D) 2 < 1 < 3
سؤال
Using acid-base extractions, how might you purify a crude sample of benzoic acid?
سؤال
Which of the following is the strongest acid?

A) chloroacetic acid
B) dichloroacetic acid
C) trichloroacetic acid
D) acetic acid
سؤال
In glutaric acid (HOOCCH2CH2CH2COOH), pKa1 is 4.35 while the pKa2 is 5.42. Why is the second carboxylic acid less acidic?
سؤال
List the following weak acids in order of increasing acidity (from lowest to highest.). <strong>List the following weak acids in order of increasing acidity (from lowest to highest.).  </strong> A) 4 < 3 < 2 < 1 < 5 B) 4 < 1 < 3 < 2 < 5 C) 5 < 2 < 3 < 1 < 4 D) 4 < 1 < 2 < 5 < 3 E) 1 < 2 < 4 < 3 < 5 <div style=padding-top: 35px>

A) 4 < 3 < 2 < 1 < 5
B) 4 < 1 < 3 < 2 < 5
C) 5 < 2 < 3 < 1 < 4
D) 4 < 1 < 2 < 5 < 3
E) 1 < 2 < 4 < 3 < 5
سؤال
Which of the following is the strongest acid?

A) acetic acid
B) chloroacetic acid
C) bromoacetic acid
D) fluoroacetic acid
سؤال
Which of the following is the strongest acid?

A) (CH3)2CHCO2H
B) CH3CH2CO2H
C) CH3OCH2CO2H
D) PhCH2CO2H
E) O2NCH2CO2H
سؤال
The 1H NMR spectrum of an unknown acid has the following peaks:
Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s)
Which structure best fits this spectral information?

A) <strong>The 1H NMR spectrum of an unknown acid has the following peaks: Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s) Which structure best fits this spectral information?</strong> A)   B)   C)   D)   <div style=padding-top: 35px>
B) <strong>The 1H NMR spectrum of an unknown acid has the following peaks: Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s) Which structure best fits this spectral information?</strong> A)   B)   C)   D)   <div style=padding-top: 35px>
C) <strong>The 1H NMR spectrum of an unknown acid has the following peaks: Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s) Which structure best fits this spectral information?</strong> A)   B)   C)   D)   <div style=padding-top: 35px>
D) <strong>The 1H NMR spectrum of an unknown acid has the following peaks: Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s) Which structure best fits this spectral information?</strong> A)   B)   C)   D)   <div style=padding-top: 35px>
سؤال
Why are the OH groups of carboxylic acids more acidic than alcohols?

A) resonance stabilization of the carboxylate ion
B) inductive electron donating by the carbonyl oxygen
C) reduced hydrogen bonding capacity
D) because they have lower pKa values
E) None of the above - carboxylic acids are not more acidic than alcohols.
سؤال
Which of the following compounds is the strongest acid?

A) p-nitrobenzoic acid
B) p-bromobenzoic acid
C) m-methylbenzoic acid
D) m-methoxybenzoic acid
E) water
سؤال
Provide the major organic product of the reaction shown below. Provide the major organic product of the reaction shown below.  <div style=padding-top: 35px>
سؤال
Name the salt formed from the reaction of acetic acid with ammonia.
سؤال
After completing the synthesis of 3-methylpentanoic acid, which of the following treatments will neutralize the mineral acids and facilitate the distribution of the organic acid from the organic layer to the aqueous extraction layer?

A) extraction with aqueous NaCl
B) extraction with ether
C) extraction with aqueous NaHCO3
D) extraction with water
E) extraction with dilute aqueous HCl
سؤال
In the mass spectrum of 3-methylhexanoic acid, predict the mass of the fragment resulting from a McLafferty rearrangement.
سؤال
Carboxylic acids can be made from Grignards by treating the Grignard reagents with ________.

A) carbon monoxide
B) esters
C) aldehydes
D) diborane
E) carbon dioxide
سؤال
What two features are prominent in the infrared spectrum of a carboxylic acid?
سؤال
How does the O-H stretch in the IR spectrum of a carboxylic acid differ from the O-H stretch of an alcohol?
سؤال
In a carboxylic acid, the hybridization of the C is ________ and the OCO bond angle is ________.

A) sp2; exactly 120°
B) sp2; greater than 120°
C) sp3; 109.5°
D) sp3; less than 120°
سؤال
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.  <div style=padding-top: 35px>
سؤال
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.  <div style=padding-top: 35px>
سؤال
2-Phenylethanol yields what acid upon treatment with cold chromic acid?
سؤال
Where would one expect to find the 1H NMR signal for the carboxyl group's hydrogen in propanoic acid?

A) δ 4.1 - 5.6 ppm
B) δ 10 - 13 ppm
C) δ 8 - 9 ppm
D) δ 6.1 - 7.8 ppm
E) δ 9.5 - 10 ppm
سؤال
An acid which could not be prepared by the reaction of an organic halide with cyanide ion followed by acid hydrolysis of the nitrile is ________.

A) propanoic acid
B) phenylacetic acid
C) acetic acid
D) (CH3)3CCO2H
E) CH3(CH2)14CO2H
سؤال
Which of the following must be converted into a carboxylic acid through nitrile hydrolysis rather than through a Grignard synthesis with Mg/ether followed with dry CO2 and work-up with H3O+? Which of the following must be converted into a carboxylic acid through nitrile hydrolysis rather than through a Grignard synthesis with Mg/ether followed with dry CO<sub>2</sub> and work-up with H<sub>3</sub>O<sup>+</sup>?  <div style=padding-top: 35px>
سؤال
Deduce a reasonable structure for the compound which exhibits the following spectroscopic data.
C5H9ClO2: IR: 2700-3400 cm-1 (broad), 1710 cm-1; 1H NMR (ppm): 1.40 (6H, singlet), 3.60 (2H, singlet), 10.1 (1H, singlet) ppm.
سؤال
In the mass spectrum of pentanoic acid, the base peak occurs at m/z ________.

A) 102
B) 101
C) 85
D) 73
E) 60
سؤال
Starting with any alkene, how could you make pimelic acid (HOOC(CH2)5COOH)?
سؤال
What compound is produced when cyclohexene is treated with concentrated KMnO4?

A) hexanoic acid
B) adipic acid
C) cyclohexanecarboxylic acid
D) benzoic acid
E) succinic acid
سؤال
1-Hexanol reacts with chromic acid to yield what product?
سؤال
What compound is produced when (CH3)2CHCH2Br is subjected to the following sequence of steps?
1) Mg, Et2O 2. CO2

A) 2-methylpropanoic acid
B) 3-methylpropanoic acid
C) 2-methylbutanoic acid
D) 3-methylbutanoic acid
E) 2-methylhexanoic acid
سؤال
An acid which could not be prepared from an organic halide by carboxylation of the Grignard reagent is ________.

A) benzoic acid
B) 2,2-dimethylpropanoic acid
C) propanoic acid
D) 4-oxocyclohexanecarboxylic acid
E) 2-methylbutanoic acid
سؤال
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.  <div style=padding-top: 35px>
سؤال
Which of the following statements is true?

A) The carbonyl carbon in a carboxylic acid does not give a 13C signal in a 13C-NMR spectrum.
B) The carbonyl carbon in a carboxylic acid gives a 13C signal in the same region as a carbonyl carbon from a ketone or aldehyde - in the range of 200 ppm.
C) The carbonyl carbon of a carboxylic acid splits a proton signal into a doublet in an H-NMR spectrum.
D) The carbonyl carbon in a carboxylic acid gives a 13C signal in the same region as a carbonyl carbon from an ester or amide in the range of 150 to 180 ppm.
E) The carbonyl carbon in a carboxylic acid cannot be distinguished from an aromatic carbon because they both give signals in the range of 110 to 130 ppm.
سؤال
Propose a reasonable synthetic route to prepare cyclohexylacetic acid from methylenecyclohexane.
سؤال
Draw a Fischer projection of the product which results when (R)-2-bromobutane is treated with the following sequence of reagents: Draw a Fischer projection of the product which results when (R)-2-bromobutane is treated with the following sequence of reagents:     and  <div style=padding-top: 35px>
Draw a Fischer projection of the product which results when (R)-2-bromobutane is treated with the following sequence of reagents:     and  <div style=padding-top: 35px>
and Draw a Fischer projection of the product which results when (R)-2-bromobutane is treated with the following sequence of reagents:     and  <div style=padding-top: 35px>
سؤال
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.  <div style=padding-top: 35px>
سؤال
Using the carboxylic acid below as your only carbon source, how would you make the given amide? Using the carboxylic acid below as your only carbon source, how would you make the given amide?  <div style=padding-top: 35px>
سؤال
Provide the major organic product of the reaction shown below. Provide the major organic product of the reaction shown below.  <div style=padding-top: 35px>
سؤال
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.  <div style=padding-top: 35px>
سؤال
Suggest a sequence of synthetic steps through which phenylacetic acid can be prepared from toluene via phenylacetonitrile.
سؤال
Suggest a sequence of synthetic steps through which p-toluic acid can be prepared from toluene.
سؤال
What two alkenes, which contain only one double bond, yield exclusively propanoic acid upon oxidation with hot concentrated KMnO4?
سؤال
Provide the major organic product of the reaction shown below. Provide the major organic product of the reaction shown below.  <div style=padding-top: 35px>
سؤال
Hept-3-yne yields what acids upon treatment with concentrated permanganate of ozone followed by water?
سؤال
Suggest a sequence of synthetic steps through which phenylacetic acid can be prepared from toluene and in which Grignard chemistry is employed.
سؤال
Provide the major organic product of the reaction shown below. Provide the major organic product of the reaction shown below.  <div style=padding-top: 35px>
سؤال
Provide the sequence of reagents needed to accomplish the conversion below. Provide the sequence of reagents needed to accomplish the conversion below.  <div style=padding-top: 35px>
سؤال
Show how you could make the acid shown below starting with any alcohol: Show how you could make the acid shown below starting with any alcohol:  <div style=padding-top: 35px>
سؤال
An unknown alkyne was subjected to concentrated KMnO4 and only one product was isolated. The spectral information for 1H NMR of the product is given below.
δ (ppm) = 11.0 (1H, broad s), 2.39 (2H, q), 1.16 (3H, t)
What is the structure of the starting alkyne?
سؤال
Provide the major organic product of the following reaction sequence. Provide the major organic product of the following reaction sequence.  <div style=padding-top: 35px>
سؤال
Show how you could convert benzene to benzoic acid.
سؤال
Which sequence of steps below describes the best synthesis of 5-oxohexanoic acid starting with 1-methylcyclopentan-1-ol?

A) 1. Conc. KMnO4
2) Dry gaseous HBr
3) mg/ether
4) CO2
B) 1. H2SO4 and heat
2) Conc. KMnO4
C) 1. Conc. KMnO4
2) CH3MgBr/ ether
3. H3O+
D) 1. H2SO4 and heat
2) O3
3) (CH3)2S
4) PCC
E) 1. H2SO4 and heat
2) Conc. KMnO4
3) LiAlH4
4) H3O+
سؤال
Provide the major organic product of the following reaction sequence. Provide the major organic product of the following reaction sequence.  <div style=padding-top: 35px>
فتح الحزمة
قم بالتسجيل لفتح البطاقات في هذه المجموعة!
Unlock Deck
Unlock Deck
1/125
auto play flashcards
العب
simple tutorial
ملء الشاشة (f)
exit full mode
Deck 20: Carboxylic Acids
1
Provide the name of the compound shown below. Provide the name of the compound shown below.
2,5-dimethyl-4-hexenoic acid or 2,5-dimethylhex-4-enoic acid
2
Provide the structure of 3,3-dimethylheptanoic acid.
CH3CH2CH2CH2C(CH3)2CH2CO2H
3
What is the common name for the following compound? <strong>What is the common name for the following compound?  </strong> A) γ-hydroxyvaleric acid B) γ-hydroxypentanoic acid C) γ-hydroxy-γ-methylbutyric acid D) δ-hydroxyvaleric acid

A) γ-hydroxyvaleric acid
B) γ-hydroxypentanoic acid
C) γ-hydroxy-γ-methylbutyric acid
D) δ-hydroxyvaleric acid
γ-hydroxyvaleric acid
4
Name the compound shown below. Name the compound shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
5
Carboxylic acids boil at considerably higher temperatures than do alcohols, ketones, or aldehydes of similar molecular weights. This is because they ________.

A) have a greater oxygen content
B) are more acidic
C) form stable hydrogen-bonded dimers
D) are hydrophobic
E) none of the above
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
6
Provide the IUPAC name for the compound shown below. Provide the IUPAC name for the compound shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
7
Provide the IUPAC name for the compound shown below. Provide the IUPAC name for the compound shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
8
Provide the IUPAC name for the compound shown below. Provide the IUPAC name for the compound shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
9
Name the compound shown below. Name the compound shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
10
Draw an acetic acid dimer. Be sure to indicate the hydrogen bonds present.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
11
Provide the IUPAC name for HO2CCH2C(CH3)2CH2CH2CO2H.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
12
Provide the structure of glutaric acid.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
13
Provide the structure of pent-3-ynoic acid.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
14
Name the compound shown below. Name the compound shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
15
Provide the structure of 3-nitrophthalic acid.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
16
The common name for pentanedioic acid is ________.

A) pimelic acid
B) oxalic acid
C) glutaric acid
D) succinic acid
E) adipic acid
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
17
Provide the structure of trans-1,3-cyclohexanedicarboxylic acid.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
18
Are carboxylic acids of more than 10 carbons more soluble in polar or nonpolar solvents?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
19
The combination of a carbonyl group and a hydroxyl group on the same carbon atom is called a ________ group.

A) carbamate
B) carbonate
C) urethane
D) carboxyl
E) carboxylate
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
20
Provide the structure of succinic acid.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
21
What products result from the reaction of sodium propanoate with hydrobromic acid?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
22
Show the deprotonation of benzoic acid by hydroxide and draw the important resonance structures of the carboxylate ion.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
23
An ether solution of PhCO2H (A), PhNH2 (B), and PhCH3 (C) is extracted with aqueous NaOH. The ether layer will contain what compound(s) after the extraction?

A) A + B
B) A + C
C) B + C
D) A + B + C
E) A only
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
24
The pKa1 for oxalic acid (pKa = 1.27) is much lower than the pKa1 of glutaric acid (pKa = 4.35). Briefly explain why.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
25
What salt results from the reaction of benzoic acid with potassium hydroxide?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
26
An unknown compound is insoluble in water but dissolves in an aqueous solution of sodium bicarbonate with a release of carbon dioxide bubbles. The compound is almost certainly ________.

A) a carboxylic acid
B) an amine
C) an aldehyde
D) an alkyl chloride
E) an alcohol
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
27
The strongest dichlorobutanoic acid is ________.

A) 2,2-dichlorobutanoic acid
B) 2,3-dichlorobutanoic acid
C) 3,3-dichlorobutanoic acid
D) 3,4-dichlorobutanoic acid
E) 4,4-dichlorobutanoic acid
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
28
Which of the following sequences ranks the structures below in order of increasing
Acidity? <strong>Which of the following sequences ranks the structures below in order of increasing Acidity?  </strong> A) 1 < 2 < 3 B) 2 < 3 < 1 C) 3 < 1 < 2 D) 2 < 1 < 3

A) 1 < 2 < 3
B) 2 < 3 < 1
C) 3 < 1 < 2
D) 2 < 1 < 3
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
29
Using acid-base extractions, how might you purify a crude sample of benzoic acid?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
30
Which of the following is the strongest acid?

A) chloroacetic acid
B) dichloroacetic acid
C) trichloroacetic acid
D) acetic acid
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
31
In glutaric acid (HOOCCH2CH2CH2COOH), pKa1 is 4.35 while the pKa2 is 5.42. Why is the second carboxylic acid less acidic?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
32
List the following weak acids in order of increasing acidity (from lowest to highest.). <strong>List the following weak acids in order of increasing acidity (from lowest to highest.).  </strong> A) 4 < 3 < 2 < 1 < 5 B) 4 < 1 < 3 < 2 < 5 C) 5 < 2 < 3 < 1 < 4 D) 4 < 1 < 2 < 5 < 3 E) 1 < 2 < 4 < 3 < 5

A) 4 < 3 < 2 < 1 < 5
B) 4 < 1 < 3 < 2 < 5
C) 5 < 2 < 3 < 1 < 4
D) 4 < 1 < 2 < 5 < 3
E) 1 < 2 < 4 < 3 < 5
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
33
Which of the following is the strongest acid?

A) acetic acid
B) chloroacetic acid
C) bromoacetic acid
D) fluoroacetic acid
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
34
Which of the following is the strongest acid?

A) (CH3)2CHCO2H
B) CH3CH2CO2H
C) CH3OCH2CO2H
D) PhCH2CO2H
E) O2NCH2CO2H
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
35
The 1H NMR spectrum of an unknown acid has the following peaks:
Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s)
Which structure best fits this spectral information?

A) <strong>The 1H NMR spectrum of an unknown acid has the following peaks: Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s) Which structure best fits this spectral information?</strong> A)   B)   C)   D)
B) <strong>The 1H NMR spectrum of an unknown acid has the following peaks: Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s) Which structure best fits this spectral information?</strong> A)   B)   C)   D)
C) <strong>The 1H NMR spectrum of an unknown acid has the following peaks: Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s) Which structure best fits this spectral information?</strong> A)   B)   C)   D)
D) <strong>The 1H NMR spectrum of an unknown acid has the following peaks: Δ (ppm) = 12.71 (1H, s), 8.04 (2H, d), 7.30 (2H, d), 2.41 (3H, s) Which structure best fits this spectral information?</strong> A)   B)   C)   D)
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
36
Why are the OH groups of carboxylic acids more acidic than alcohols?

A) resonance stabilization of the carboxylate ion
B) inductive electron donating by the carbonyl oxygen
C) reduced hydrogen bonding capacity
D) because they have lower pKa values
E) None of the above - carboxylic acids are not more acidic than alcohols.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
37
Which of the following compounds is the strongest acid?

A) p-nitrobenzoic acid
B) p-bromobenzoic acid
C) m-methylbenzoic acid
D) m-methoxybenzoic acid
E) water
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
38
Provide the major organic product of the reaction shown below. Provide the major organic product of the reaction shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
39
Name the salt formed from the reaction of acetic acid with ammonia.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
40
After completing the synthesis of 3-methylpentanoic acid, which of the following treatments will neutralize the mineral acids and facilitate the distribution of the organic acid from the organic layer to the aqueous extraction layer?

A) extraction with aqueous NaCl
B) extraction with ether
C) extraction with aqueous NaHCO3
D) extraction with water
E) extraction with dilute aqueous HCl
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
41
In the mass spectrum of 3-methylhexanoic acid, predict the mass of the fragment resulting from a McLafferty rearrangement.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
42
Carboxylic acids can be made from Grignards by treating the Grignard reagents with ________.

A) carbon monoxide
B) esters
C) aldehydes
D) diborane
E) carbon dioxide
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
43
What two features are prominent in the infrared spectrum of a carboxylic acid?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
44
How does the O-H stretch in the IR spectrum of a carboxylic acid differ from the O-H stretch of an alcohol?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
45
In a carboxylic acid, the hybridization of the C is ________ and the OCO bond angle is ________.

A) sp2; exactly 120°
B) sp2; greater than 120°
C) sp3; 109.5°
D) sp3; less than 120°
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
46
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
47
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
48
2-Phenylethanol yields what acid upon treatment with cold chromic acid?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
49
Where would one expect to find the 1H NMR signal for the carboxyl group's hydrogen in propanoic acid?

A) δ 4.1 - 5.6 ppm
B) δ 10 - 13 ppm
C) δ 8 - 9 ppm
D) δ 6.1 - 7.8 ppm
E) δ 9.5 - 10 ppm
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
50
An acid which could not be prepared by the reaction of an organic halide with cyanide ion followed by acid hydrolysis of the nitrile is ________.

A) propanoic acid
B) phenylacetic acid
C) acetic acid
D) (CH3)3CCO2H
E) CH3(CH2)14CO2H
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
51
Which of the following must be converted into a carboxylic acid through nitrile hydrolysis rather than through a Grignard synthesis with Mg/ether followed with dry CO2 and work-up with H3O+? Which of the following must be converted into a carboxylic acid through nitrile hydrolysis rather than through a Grignard synthesis with Mg/ether followed with dry CO<sub>2</sub> and work-up with H<sub>3</sub>O<sup>+</sup>?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
52
Deduce a reasonable structure for the compound which exhibits the following spectroscopic data.
C5H9ClO2: IR: 2700-3400 cm-1 (broad), 1710 cm-1; 1H NMR (ppm): 1.40 (6H, singlet), 3.60 (2H, singlet), 10.1 (1H, singlet) ppm.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
53
In the mass spectrum of pentanoic acid, the base peak occurs at m/z ________.

A) 102
B) 101
C) 85
D) 73
E) 60
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
54
Starting with any alkene, how could you make pimelic acid (HOOC(CH2)5COOH)?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
55
What compound is produced when cyclohexene is treated with concentrated KMnO4?

A) hexanoic acid
B) adipic acid
C) cyclohexanecarboxylic acid
D) benzoic acid
E) succinic acid
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
56
1-Hexanol reacts with chromic acid to yield what product?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
57
What compound is produced when (CH3)2CHCH2Br is subjected to the following sequence of steps?
1) Mg, Et2O 2. CO2

A) 2-methylpropanoic acid
B) 3-methylpropanoic acid
C) 2-methylbutanoic acid
D) 3-methylbutanoic acid
E) 2-methylhexanoic acid
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
58
An acid which could not be prepared from an organic halide by carboxylation of the Grignard reagent is ________.

A) benzoic acid
B) 2,2-dimethylpropanoic acid
C) propanoic acid
D) 4-oxocyclohexanecarboxylic acid
E) 2-methylbutanoic acid
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
59
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
60
Which of the following statements is true?

A) The carbonyl carbon in a carboxylic acid does not give a 13C signal in a 13C-NMR spectrum.
B) The carbonyl carbon in a carboxylic acid gives a 13C signal in the same region as a carbonyl carbon from a ketone or aldehyde - in the range of 200 ppm.
C) The carbonyl carbon of a carboxylic acid splits a proton signal into a doublet in an H-NMR spectrum.
D) The carbonyl carbon in a carboxylic acid gives a 13C signal in the same region as a carbonyl carbon from an ester or amide in the range of 150 to 180 ppm.
E) The carbonyl carbon in a carboxylic acid cannot be distinguished from an aromatic carbon because they both give signals in the range of 110 to 130 ppm.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
61
Propose a reasonable synthetic route to prepare cyclohexylacetic acid from methylenecyclohexane.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
62
Draw a Fischer projection of the product which results when (R)-2-bromobutane is treated with the following sequence of reagents: Draw a Fischer projection of the product which results when (R)-2-bromobutane is treated with the following sequence of reagents:     and
Draw a Fischer projection of the product which results when (R)-2-bromobutane is treated with the following sequence of reagents:     and
and Draw a Fischer projection of the product which results when (R)-2-bromobutane is treated with the following sequence of reagents:     and
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
63
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
64
Using the carboxylic acid below as your only carbon source, how would you make the given amide? Using the carboxylic acid below as your only carbon source, how would you make the given amide?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
65
Provide the major organic product of the reaction shown below. Provide the major organic product of the reaction shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
66
Provide the major organic product of the following reaction. Provide the major organic product of the following reaction.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
67
Suggest a sequence of synthetic steps through which phenylacetic acid can be prepared from toluene via phenylacetonitrile.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
68
Suggest a sequence of synthetic steps through which p-toluic acid can be prepared from toluene.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
69
What two alkenes, which contain only one double bond, yield exclusively propanoic acid upon oxidation with hot concentrated KMnO4?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
70
Provide the major organic product of the reaction shown below. Provide the major organic product of the reaction shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
71
Hept-3-yne yields what acids upon treatment with concentrated permanganate of ozone followed by water?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
72
Suggest a sequence of synthetic steps through which phenylacetic acid can be prepared from toluene and in which Grignard chemistry is employed.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
73
Provide the major organic product of the reaction shown below. Provide the major organic product of the reaction shown below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
74
Provide the sequence of reagents needed to accomplish the conversion below. Provide the sequence of reagents needed to accomplish the conversion below.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
75
Show how you could make the acid shown below starting with any alcohol: Show how you could make the acid shown below starting with any alcohol:
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
76
An unknown alkyne was subjected to concentrated KMnO4 and only one product was isolated. The spectral information for 1H NMR of the product is given below.
δ (ppm) = 11.0 (1H, broad s), 2.39 (2H, q), 1.16 (3H, t)
What is the structure of the starting alkyne?
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
77
Provide the major organic product of the following reaction sequence. Provide the major organic product of the following reaction sequence.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
78
Show how you could convert benzene to benzoic acid.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
79
Which sequence of steps below describes the best synthesis of 5-oxohexanoic acid starting with 1-methylcyclopentan-1-ol?

A) 1. Conc. KMnO4
2) Dry gaseous HBr
3) mg/ether
4) CO2
B) 1. H2SO4 and heat
2) Conc. KMnO4
C) 1. Conc. KMnO4
2) CH3MgBr/ ether
3. H3O+
D) 1. H2SO4 and heat
2) O3
3) (CH3)2S
4) PCC
E) 1. H2SO4 and heat
2) Conc. KMnO4
3) LiAlH4
4) H3O+
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
80
Provide the major organic product of the following reaction sequence. Provide the major organic product of the following reaction sequence.
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.
فتح الحزمة
k this deck
locked card icon
فتح الحزمة
افتح القفل للوصول البطاقات البالغ عددها 125 في هذه المجموعة.