If the H⁺ concentration in a carbonated beverage is 4.7 × 10−⁵ M,what is the OH− concentration? (K_w = 1.0 × 10−¹⁴)

Question

Quizplus · Accepted Answer

First, we need to write the equation for the reaction of HS1U1P1+S1S1P0 with water:

HS1U1P1+S1S1P0 + H2O ⇌ H2S1U1P1 + OH-

The equilibrium constant expression is:

KS1U1B1wS1U1B0 = [H2S1U1P1][OH-]/[HS1U1P1+S1S1P0]

We are given the value of KS1U1B1wS1U1B0 and the concentration of HS1U1P1+S1S1P0. We need to find [OH-].

To find [OH-], we can use the equilibrium constant expression and solve for [OH-]:

[OH-] = KS1U1B1wS1U1B0 [HS1U1P1+S1S1P0]/[H2S1U1P1]

Substituting the given values:

[OH-] = (1.0 × 10−S1U1P114S1S1P0)(4.7 × 10−S1U1P15S1S1P0)/(1.0 × 10−S1U1P115S1S1P0)

Simplifying:

[OH-] = 2.1 × 10−S1U1P110S1S1P0 M

Therefore, the correct answer is choice B.

If the H+ Concentration in a Carbonated Beverage Is 4