Complete and balance the following redox equation. What is the coefficient of OH^-when the equation is balanced using the set of smallest whole-number coefficients? MnO₄^- + I^- $\to$ MnO₂ + IO₃^- (basic solution)

Question

Quizplus · Accepted Answer

First, we need to identify the oxidation states of each element in the equation:

Mn: +2 to +7
I: -1 to +7
O: -2
H: +1
S: -2
P: +3 to +5
F: -1

Next, we need to balance the equation by adding coefficients so that the number of atoms of each element is the same on both sides of the equation.

MnO(S2B14S)(S2B0P1)(S0P0S) + I(S1B13S)(S1B0P1)(S0P0S)2- = MnO(S2B12S)(S2B0P1) + I(S1B13S)(S1B0P1)(S0P0S)2- + F(S1)

To balance the equation, we first balance the elements that appear in only one molecule on each side. We add a coefficient of 2 in front of IF and a coefficient of 2 in front of IO.

MnO(S2B14S)(S2B0P1)(S0P0S) + 2I(S1B13S)(S1B0P1)(S0P0S)2- + F(S1)2 = MnO(S2B12S)(S2B0P1) + 2I(S1B13S)(S1B0P1)(S0P0S)2-

Next, we balance the oxygens by adding H2O on the left side. We need 7 H2O molecules.

MnO(S2B14S)(S2B0P1)(S0P0S) + 2I(S1B13S)(S1B0P1)(S0P0S)2- + F(S1)2 = MnO(S2B12S)(S2B0P1) + 2I(S1B13S)(S1B0P1)(S0P0S)2- + 7H2O

Now we have 14 H atoms and 14 O atoms on the left side and 14 H atoms and 14 O atoms on the right side. Next, we balance the hydrogens by adding OH- on the right side. We need 16 OH- ions.

MnO(S2B14S)(S2B0P1)(S0P0S) + 2I(S1B13S)(S1B0P1)(S0P0S)2- + F(S1)2 = MnO(S2B12S)(S2B0P1) + 2I(S1B13S)(S1B0P1)(S0P0S)2- + 7H2O + 16OH-

Now we have the same number of H and O atoms on both sides. Finally, we balance the charges by adding electrons. We need 10 electrons on the left side and 2 electrons on the right side.

MnO(S2B14S)(S2B0P1)(S0P0S) + 2I(S1B13S)(S1B0P1)(S0P0S)2- + F(S1)2 + 10e- = MnO(S2B12S)(S2B0P1) + 2I(S1B13S)(S1B0P1)(S0P0S)2- + 7H2O + 16OH- + 2e-

Therefore, the coefficient of S1S1P0 is 2. Option B is correct.

Complete and Balance the Following Redox Equation →\to→ MnO2 + IO3- (Basic Solution) A)1 B)2 C)4 D)10 E)None

Complete and Balance the Following Redox Equation $\to$ MnO₂ + IO₃^- (Basic Solution)
A)1
B)2
C)4
D)10
E)None