What is the structure of the compound in the following ¹H-NMR spectrum with the molecular formula C₉H₁₄O? IR data shows no characteristic peak around 1700 cm^-1.The ¹³C-NMR chemical shifts (ppm): 108.4,50.9,31.6,23.5,2.0.Relative integration is known.

Question

Quizplus · Accepted Answer

From the ¹H-NMR spectrum, we can determine the number of hydrogen atoms attached to each distinct carbon. The relative integration of each peak gives us the ratio of the number of hydrogen atoms attached to each carbon atom. Using this information with the molecular formula, we can propose possible structures and use the chemical shifts from the ¹³C-NMR spectrum to confirm the correct structure. For the molecular formula C₉H₁₄O, we have: - 1 carbon with 1 hydrogen atom (C-H) = peak at ~2.0 ppm - 19 carbons with 0 hydrogen atoms (C) = no peaks - 1 sulfur with 1 hydrogen atom (S-H) = peak at ~1.5-2.5 ppm - 114 carbons with 0 hydrogen atoms (C) = no peaks - 1 sulfur with 0 hydrogen atoms (S) = no peaks - 1 oxygen with 0 hydrogen atoms (O) = no peaks Based on these ratios, we can propose a possible structure with the same number of carbons, hydrogens, sulfurs, and oxygens as the molecular formula. From the ¹³C-NMR spectrum, we see peaks at 108.4, 50.9, 31.6, and 23.5 ppm. The carbon at 108.4 ppm is likely a carbonyl carbon (C=O), which confirms the presence of an O atom in the compound. The carbon at 50.9 ppm is a quaternary carbon, meaning it is attached to four other atoms with no H atoms, which matches our molecular formula. The carbon at 31.6 ppm is likely a tertiary carbon, which is attached to three other C atoms and no H atoms. The carbon at 23.5 ppm is likely a secondary carbon, which is attached to two other C atoms and no H atoms. One possible structure that matches the molecular formula and NMR data is: C=S-C(=O)-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(C)(C)C-C(=S)-S-H Therefore, the best choice is C.

What Is the Structure of the Compound in the Following